C36H47FO5 — CID 134246562
[2-[[4-[4-[2-[4-(4-fluorobutyl)cyclohexyl]ethyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246562) has the molecular formula C36H47FO5 and a molecular weight of 578.76 g/mol. Its IUPAC name is [2-[[4-[4-[2-[4-(4-fluorobutyl)cyclohexyl]ethyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[[4-[4-[2-[4-(4-fluorobutyl)cyclohexyl]ethyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246562 |
| Molecular Formula | C36H47FO5 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | [2-[[4-[4-[2-[4-(4-fluorobutyl)cyclohexyl]ethyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)Cc1ccc(-c2ccc(CCC3CCC(CCCCF)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H47FO5/c1-26(2)35(39)41-24-32(25-42-36(40)27(3)23-38)22-31-15-19-34(20-16-31)33-17-13-30(14-18-33)12-11-29-9-7-28(8-10-29)6-4-5-21-37/h13-20,28-29,32,38H,1,3-12,21-25H2,2H3 |
| InChIKey | QIXJIOUFXKLNNY-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|