C36H52O3 — CID 134244421
[2-[[4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]phenyl]methyl]-3-hydroxypropyl] 2,3-dimethylbut-2-enoate (PubChem CID 134244421) has the molecular formula C36H52O3 and a molecular weight of 532.81 g/mol. Its IUPAC name is [2-[[4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]phenyl]methyl]-3-hydroxypropyl] 2,3-dimethylbut-2-enoate.
| Compound Name | [2-[[4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]phenyl]methyl]-3-hydroxypropyl] 2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 134244421 |
| Molecular Formula | C36H52O3 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | [2-[[4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]phenyl]methyl]-3-hydroxypropyl] 2,3-dimethylbut-2-enoate |
| SMILES | CCCCCCC1CCC(CCc2ccc(-c3ccc(CC(CO)COC(=O)C(C)=C(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C36H52O3/c1-5-6-7-8-9-29-10-12-30(13-11-29)14-15-31-16-20-34(21-17-31)35-22-18-32(19-23-35)24-33(25-37)26-39-36(38)28(4)27(2)3/h16-23,29-30,33,37H,5-15,24-26H2,1-4H3 |
| InChIKey | MHVAHQMWTJNPFG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|