C36H48O6 — CID 134244596
[3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134244596) has the molecular formula C36H48O6 and a molecular weight of 576.77 g/mol. Its IUPAC name is [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134244596 |
| Molecular Formula | C36H48O6 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)CO)c1ccc(-c2ccc(CCC3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H48O6/c1-4-5-6-7-28-8-10-29(11-9-28)12-13-30-14-16-31(17-15-30)32-18-20-33(21-19-32)34(24-41-35(39)26(2)22-37)25-42-36(40)27(3)23-38/h14-21,28-29,34,37-38H,2-13,22-25H2,1H3 |
| InChIKey | NQMLAMAEVNOMGR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|