C32H44O4 — CID 155029880
[3-methoxy-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 155029880) has the molecular formula C32H44O4 and a molecular weight of 492.70 g/mol. Its IUPAC name is [3-methoxy-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [3-methoxy-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155029880 |
| Molecular Formula | C32H44O4 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | [3-methoxy-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCC(COC)c1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H44O4/c1-5-6-7-8-25-9-11-26(12-10-25)27-13-15-28(16-14-27)29-17-19-30(20-18-29)31(22-35-4)23-36-32(33)24(2)21-34-3/h13-20,25-26,31H,2,5-12,21-23H2,1,3-4H3 |
| InChIKey | DIDVQDHEKCTGOH-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|