C36H48O5 — CID 148705700
[3-(2-methylprop-2-enoyloxy)-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 148705700) has the molecular formula C36H48O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 148705700 |
| Molecular Formula | C36H48O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]propyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C(C)(C)O)c1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H48O5/c1-7-8-9-10-27-11-13-28(14-12-27)29-15-17-30(18-16-29)31-19-21-32(22-20-31)33(23-40-34(37)25(2)3)24-41-35(38)26(4)36(5,6)39/h15-22,27-28,33,39H,2,4,7-14,23-24H2,1,3,5-6H3 |
| InChIKey | NWFNOFULPICLNM-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|