C41H56O5 — CID 148984226
[3-(2-methylprop-2-enoyloxy)-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]propyl] 3-hydroxy-2-methylidenebutanoate (PubChem CID 148984226) has the molecular formula C41H56O5 and a molecular weight of 628.89 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]propyl] 3-hydroxy-2-methylidenebutanoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]propyl] 3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 148984226 |
| Molecular Formula | C41H56O5 |
| Molecular Weight | 628.89 g/mol |
| Exact Mass | 628.41 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]propyl] 3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C(C)O)c1ccc(-c2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C41H56O5/c1-6-7-8-9-31-10-12-32(13-11-31)33-14-16-34(17-15-33)35-18-20-36(21-19-35)37-22-24-38(25-23-37)39(26-45-40(43)28(2)3)27-46-41(44)29(4)30(5)42/h18-25,30-34,39,42H,2,4,6-17,26-27H2,1,3,5H3 |
| InChIKey | PWIUFHMABJZPCB-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.89 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|