C34H50O6 — CID 134246128
[3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246128) has the molecular formula C34H50O6 and a molecular weight of 554.77 g/mol. Its IUPAC name is [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246128 |
| Molecular Formula | C34H50O6 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)CO)c1ccc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H50O6/c1-4-5-6-7-26-8-10-27(11-9-26)28-12-14-29(15-13-28)30-16-18-31(19-17-30)32(22-39-33(37)24(2)20-35)23-40-34(38)25(3)21-36/h16-19,26-29,32,35-36H,2-15,20-23H2,1H3 |
| InChIKey | BVSLZSLLFWCSSP-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|