C33H53NO2 — CID 145412014
[3-(methylamino)-2-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]propyl] 2-methylprop-2-enoate (PubChem CID 145412014) has the molecular formula C33H53NO2 and a molecular weight of 495.79 g/mol. Its IUPAC name is [3-(methylamino)-2-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3-(methylamino)-2-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145412014 |
| Molecular Formula | C33H53NO2 |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.41 |
| IUPAC Name | [3-(methylamino)-2-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CNC)c1ccc(CCC2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C33H53NO2/c1-5-6-7-8-26-11-17-29(18-12-26)30-19-13-27(14-20-30)9-10-28-15-21-31(22-16-28)32(23-34-4)24-36-33(35)25(2)3/h15-16,21-22,26-27,29-30,32,34H,2,5-14,17-20,23-24H2,1,3-4H3 |
| InChIKey | UPJPRGIVTIORKQ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|