C33H46O5 — CID 145412026
2-methylprop-2-enal;(4-pentylcyclohexyl) 4-[4-[2-(hydroxymethyl)-3-methoxypropyl]phenyl]benzoate (PubChem CID 145412026) has the molecular formula C33H46O5 and a molecular weight of 522.73 g/mol. Its IUPAC name is 2-methylprop-2-enal;(4-pentylcyclohexyl) 4-[4-[2-(hydroxymethyl)-3-methoxypropyl]phenyl]benzoate.
| Compound Name | 2-methylprop-2-enal;(4-pentylcyclohexyl) 4-[4-[2-(hydroxymethyl)-3-methoxypropyl]phenyl]benzoate |
|---|---|
| PubChem CID | 145412026 |
| Molecular Formula | C33H46O5 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 2-methylprop-2-enal;(4-pentylcyclohexyl) 4-[4-[2-(hydroxymethyl)-3-methoxypropyl]phenyl]benzoate |
| SMILES | C=C(C)C=O.CCCCCC1CCC(OC(=O)c2ccc(-c3ccc(CC(CO)COC)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H40O4.C4H6O/c1-3-4-5-6-22-9-17-28(18-10-22)33-29(31)27-15-13-26(14-16-27)25-11-7-23(8-12-25)19-24(20-30)21-32-2;1-4(2)3-5/h7-8,11-16,22,24,28,30H,3-6,9-10,17-21H2,1-2H3;3H,1H2,2H3 |
| InChIKey | OLHJRGQDXBPHKY-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|