C44H62O3 — CID 142282721
2-(methoxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]naphthalen-2-yl]propan-1-ol;2-methylprop-2-enal (PubChem CID 142282721) has the molecular formula C44H62O3 and a molecular weight of 638.98 g/mol. Its IUPAC name is 2-(methoxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]naphthalen-2-yl]propan-1-ol;2-methylprop-2-enal.
| Compound Name | 2-(methoxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]naphthalen-2-yl]propan-1-ol;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142282721 |
| Molecular Formula | C44H62O3 |
| Molecular Weight | 638.98 g/mol |
| Exact Mass | 638.47 |
| IUPAC Name | 2-(methoxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]naphthalen-2-yl]propan-1-ol;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CCCCCC1CCC(C2CCC(c3ccc(CCc4ccc5cc(CC(CO)COC)ccc5c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C40H56O2.C4H6O/c1-3-4-5-6-30-9-15-35(16-10-30)37-21-23-38(24-22-37)36-17-11-31(12-18-36)7-8-32-13-19-40-27-33(14-20-39(40)26-32)25-34(28-41)29-42-2;1-4(2)3-5/h11-14,17-20,26-27,30,34-35,37-38,41H,3-10,15-16,21-25,28-29H2,1-2H3;3H,1H2,2H3 |
| InChIKey | FUBASIGDMBPMIL-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.98 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|