C40H63NO2 — CID 142283201
1-[4-[4-(3-methoxy-2-methylpropyl)cyclohexyl]cyclohexyl]-4-(4-pentylphenyl)benzene;N-methylmethanamine;2-methylprop-2-enal (PubChem CID 142283201) has the molecular formula C40H63NO2 and a molecular weight of 589.95 g/mol. Its IUPAC name is 1-[4-[4-(3-methoxy-2-methylpropyl)cyclohexyl]cyclohexyl]-4-(4-pentylphenyl)benzene;N-methylmethanamine;2-methylprop-2-enal.
| Compound Name | 1-[4-[4-(3-methoxy-2-methylpropyl)cyclohexyl]cyclohexyl]-4-(4-pentylphenyl)benzene;N-methylmethanamine;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142283201 |
| Molecular Formula | C40H63NO2 |
| Molecular Weight | 589.95 g/mol |
| Exact Mass | 589.49 |
| IUPAC Name | 1-[4-[4-(3-methoxy-2-methylpropyl)cyclohexyl]cyclohexyl]-4-(4-pentylphenyl)benzene;N-methylmethanamine;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CCCCCc1ccc(-c2ccc(C3CCC(C4CCC(CC(C)COC)CC4)CC3)cc2)cc1.CNC |
| InChI | InChI=1S/C34H50O.C4H6O.C2H7N/c1-4-5-6-7-27-8-12-29(13-9-27)31-16-20-33(21-17-31)34-22-18-32(19-23-34)30-14-10-28(11-15-30)24-26(2)25-35-3;1-4(2)3-5;1-3-2/h8-9,12-13,16-17,20-21,26,28,30,32,34H,4-7,10-11,14-15,18-19,22-25H2,1-3H3;3H,1H2,2H3;3H,1-2H3 |
| InChIKey | UNQUNCRHOLEDJZ-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.95 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|