C41H57NO4 — CID 134246376
[4-(2-methylprop-2-enoyloxy)-3-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-(aminomethyl)prop-2-enoate (PubChem CID 134246376) has the molecular formula C41H57NO4 and a molecular weight of 627.91 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoyloxy)-3-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-(aminomethyl)prop-2-enoate.
| Compound Name | [4-(2-methylprop-2-enoyloxy)-3-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-(aminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246376 |
| Molecular Formula | C41H57NO4 |
| Molecular Weight | 627.91 g/mol |
| Exact Mass | 627.43 |
| IUPAC Name | [4-(2-methylprop-2-enoyloxy)-3-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-(aminomethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCOC(=O)C(=C)CN)C1CCC(C2CCC(c3ccc(-c4ccc(CCCCC)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C41H57NO4/c1-5-6-7-8-31-9-11-32(12-10-31)33-13-15-34(16-14-33)35-17-19-36(20-18-35)37-21-23-38(24-22-37)39(28-46-40(43)29(2)3)25-26-45-41(44)30(4)27-42/h9-16,35-39H,2,4-8,17-28,42H2,1,3H3 |
| InChIKey | TVBLZTUQKVRWLX-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.91 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|