C27H42O3 — CID 145412006
[5-hydroxy-3-[[4-(4-pentylphenyl)cyclohexyl]methyl]pentyl] 2-methylprop-2-enoate (PubChem CID 145412006) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is [5-hydroxy-3-[[4-(4-pentylphenyl)cyclohexyl]methyl]pentyl] 2-methylprop-2-enoate.
| Compound Name | [5-hydroxy-3-[[4-(4-pentylphenyl)cyclohexyl]methyl]pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145412006 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | [5-hydroxy-3-[[4-(4-pentylphenyl)cyclohexyl]methyl]pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CCO)CC1CCC(c2ccc(CCCCC)cc2)CC1 |
| InChI | InChI=1S/C27H42O3/c1-4-5-6-7-22-8-12-25(13-9-22)26-14-10-23(11-15-26)20-24(16-18-28)17-19-30-27(29)21(2)3/h8-9,12-13,23-24,26,28H,2,4-7,10-11,14-20H2,1,3H3 |
| InChIKey | IWIKFUJNONHFER-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|