C42H66O5 — CID 134246454
[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-6-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]hexyl] 2-methylidenebutanoate (PubChem CID 134246454) has the molecular formula C42H66O5 and a molecular weight of 650.98 g/mol. Its IUPAC name is [3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-6-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]hexyl] 2-methylidenebutanoate.
| Compound Name | [3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-6-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]hexyl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 134246454 |
| Molecular Formula | C42H66O5 |
| Molecular Weight | 650.98 g/mol |
| Exact Mass | 650.49 |
| IUPAC Name | [3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-6-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]hexyl] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCCC(CCCc1ccc(C2CCC(CCC3CCC(CCCCC)CC3)CC2)cc1)CCOC(=O)C(=C)CO |
| InChI | InChI=1S/C42H66O5/c1-5-7-8-10-34-13-15-37(16-14-34)17-18-38-21-25-40(26-22-38)39-23-19-35(20-24-39)11-9-12-36(27-29-46-41(44)32(3)6-2)28-30-47-42(45)33(4)31-43/h19-20,23-24,34,36-38,40,43H,3-18,21-22,25-31H2,1-2H3 |
| InChIKey | FHDQYYIUQSSOHZ-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.98 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|