C37H56O5 — CID 134246668
[2-[[3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246668) has the molecular formula C37H56O5 and a molecular weight of 580.85 g/mol. Its IUPAC name is [2-[[3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[[3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246668 |
| Molecular Formula | C37H56O5 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | [2-[[3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)CC1CCC(C2CCC(c3ccc(CCCCC)cc3)CC2)C(CC)C1 |
| InChI | InChI=1S/C37H56O5/c1-6-8-9-10-28-11-14-32(15-12-28)33-16-18-34(19-17-33)35-20-13-29(22-31(35)7-2)21-30(24-41-36(39)26(3)4)25-42-37(40)27(5)23-38/h11-12,14-15,29-31,33-35,38H,3,5-10,13,16-25H2,1-2,4H3 |
| InChIKey | HVHHWBQULWQAFA-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|