C30H44O7 — CID 138711016
[2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-3-[4-(4-pentylphenyl)cyclohexyl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138711016) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-3-[4-(4-pentylphenyl)cyclohexyl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-3-[4-(4-pentylphenyl)cyclohexyl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138711016 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-3-[4-(4-pentylphenyl)cyclohexyl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)COC)COC1CCC(c2ccc(CCCCC)cc2)CC1 |
| InChI | InChI=1S/C30H44O7/c1-5-6-7-8-24-9-11-26(12-10-24)27-13-15-28(16-14-27)35-19-25(20-36-29(32)22(2)17-31)21-37-30(33)23(3)18-34-4/h9-12,25,27-28,31H,2-3,5-8,13-21H2,1,4H3 |
| InChIKey | FJFJVJVAVSFCDM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|