C32H42O5 — CID 142282177
[2-(methoxymethyl)-3-[4-[4-(4-pentylphenyl)phenyl]cyclohex-3-en-1-yl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 142282177) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is [2-(methoxymethyl)-3-[4-[4-(4-pentylphenyl)phenyl]cyclohex-3-en-1-yl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-(methoxymethyl)-3-[4-[4-(4-pentylphenyl)phenyl]cyclohex-3-en-1-yl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 142282177 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | [2-(methoxymethyl)-3-[4-[4-(4-pentylphenyl)phenyl]cyclohex-3-en-1-yl]oxypropyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC)COC1CC=C(c2ccc(-c3ccc(CCCCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H42O5/c1-4-5-6-7-25-8-10-27(11-9-25)28-12-14-29(15-13-28)30-16-18-31(19-17-30)36-22-26(21-35-3)23-37-32(34)24(2)20-33/h8-16,26,31,33H,2,4-7,17-23H2,1,3H3 |
| InChIKey | AVGUODNSOZVWQD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|