C41H54O8 — CID 134246660
2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246660) has the molecular formula C41H54O8 and a molecular weight of 674.87 g/mol. Its IUPAC name is 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246660 |
| Molecular Formula | C41H54O8 |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.38 |
| IUPAC Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC(=O)C(=C)CO)cc(-c2ccc(C3=CCC(C4CCC(CCCCC)CC4)CC3)cc2)c1 |
| InChI | InChI=1S/C41H54O8/c1-4-5-6-7-31-8-10-32(11-9-31)33-12-14-34(15-13-33)35-16-18-36(19-17-35)37-24-38(46-20-22-48-40(44)29(2)27-42)26-39(25-37)47-21-23-49-41(45)30(3)28-43/h14,16-19,24-26,31-33,42-43H,2-13,15,20-23,27-28H2,1H3 |
| InChIKey | HRJJLZWSRWCKFS-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|