C40H48O7 — CID 161330207
[3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 161330207) has the molecular formula C40H48O7 and a molecular weight of 640.82 g/mol. Its IUPAC name is [3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 161330207 |
| Molecular Formula | C40H48O7 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | [3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=C)OCOc1cc(OCOC(=O)C(=C)CO)cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2)c1 |
| InChI | InChI=1S/C40H48O7/c1-5-6-7-8-31-9-11-32(12-10-31)33-13-15-34(16-14-33)35-17-19-36(20-18-35)37-21-38(45-26-44-30(4)28(2)24-41)23-39(22-37)46-27-47-40(43)29(3)25-42/h13-23,31-32,41-42H,2-12,24-27H2,1H3 |
| InChIKey | VLHVHYJSIULACX-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|