C37H44O6 — CID 135164114
[7-[4-(4-heptylcyclohexyl)phenyl]-4-[2-(hydroxymethyl)prop-2-enoyloxy]naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135164114) has the molecular formula C37H44O6 and a molecular weight of 584.75 g/mol. Its IUPAC name is [7-[4-(4-heptylcyclohexyl)phenyl]-4-[2-(hydroxymethyl)prop-2-enoyloxy]naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [7-[4-(4-heptylcyclohexyl)phenyl]-4-[2-(hydroxymethyl)prop-2-enoyloxy]naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135164114 |
| Molecular Formula | C37H44O6 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | [7-[4-(4-heptylcyclohexyl)phenyl]-4-[2-(hydroxymethyl)prop-2-enoyloxy]naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)Oc1cc(OC(=O)C(=C)CO)c2ccc(-c3ccc(C4CCC(CCCCCCC)CC4)cc3)cc2c1 |
| InChI | InChI=1S/C37H44O6/c1-4-5-6-7-8-9-27-10-12-28(13-11-27)29-14-16-30(17-15-29)31-18-19-34-32(20-31)21-33(42-36(40)25(2)23-38)22-35(34)43-37(41)26(3)24-39/h14-22,27-28,38-39H,2-13,23-24H2,1H3 |
| InChIKey | PLTBJCVGCUCWRE-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|