C31H38O6 — CID 134244900
[3-[2-(hydroxymethyl)prop-2-enoyloxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134244900) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is [3-[2-(hydroxymethyl)prop-2-enoyloxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134244900 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)Oc1cc(OC(=O)C(=C)CO)cc(-c2ccc(C3CCC(CCCCC)CC3)cc2)c1 |
| InChI | InChI=1S/C31H38O6/c1-4-5-6-7-23-8-10-24(11-9-23)25-12-14-26(15-13-25)27-16-28(36-30(34)21(2)19-32)18-29(17-27)37-31(35)22(3)20-33/h12-18,23-24,32-33H,2-11,19-20H2,1H3 |
| InChIKey | JMYVESHMCIDNMJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|