C40H58O8 — CID 142282622
2-[3-[6-hydroxy-5-(hydroxymethyl)-3-methylidenehexoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethyl 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate (PubChem CID 142282622) has the molecular formula C40H58O8 and a molecular weight of 666.90 g/mol. Its IUPAC name is 2-[3-[6-hydroxy-5-(hydroxymethyl)-3-methylidenehexoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethyl 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate.
| Compound Name | 2-[3-[6-hydroxy-5-(hydroxymethyl)-3-methylidenehexoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethyl 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
|---|---|
| PubChem CID | 142282622 |
| Molecular Formula | C40H58O8 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.41 |
| IUPAC Name | 2-[3-[6-hydroxy-5-(hydroxymethyl)-3-methylidenehexoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethyl 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
| SMILES | C=C(CCOc1cc(OCCOC(=O)C(=C)CC(CO)CO)cc(-c2ccc(C3CCC(CCCCC)CC3)cc2)c1)CC(CO)CO |
| InChI | InChI=1S/C40H58O8/c1-4-5-6-7-31-8-10-34(11-9-31)35-12-14-36(15-13-35)37-22-38(46-17-16-29(2)20-32(25-41)26-42)24-39(23-37)47-18-19-48-40(45)30(3)21-33(27-43)28-44/h12-15,22-24,31-34,41-44H,2-11,16-21,25-28H2,1H3 |
| InChIKey | MJERZGSSGYTYRS-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|