C34H47FO8 — CID 145275779
2-[3-[2-(1,3-dihydroxy-2-methylpropoxy)ethoxy]-5-[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145275779) has the molecular formula C34H47FO8 and a molecular weight of 602.74 g/mol. Its IUPAC name is 2-[3-[2-(1,3-dihydroxy-2-methylpropoxy)ethoxy]-5-[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-[2-(1,3-dihydroxy-2-methylpropoxy)ethoxy]-5-[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145275779 |
| Molecular Formula | C34H47FO8 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | 2-[3-[2-(1,3-dihydroxy-2-methylpropoxy)ethoxy]-5-[4-[4-(4-fluorobutyl)cyclohexyl]phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC(O)C(C)CO)cc(-c2ccc(C3CCC(CCCCF)CC3)cc2)c1 |
| InChI | InChI=1S/C34H47FO8/c1-24(22-36)33(38)42-17-15-40-31-19-30(20-32(21-31)41-16-18-43-34(39)25(2)23-37)29-12-10-28(11-13-29)27-8-6-26(7-9-27)5-3-4-14-35/h10-13,19-21,25-27,34,36-37,39H,1,3-9,14-18,22-23H2,2H3 |
| InChIKey | MGOHGOVAEZLIQV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|