C37H48O10 — CID 134245161
3-[2-[3-[2-(4,4-dihydroxy-2-methylidenebutanoyl)oxyethoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethoxycarbonyl]but-3-enoic acid (PubChem CID 134245161) has the molecular formula C37H48O10 and a molecular weight of 652.78 g/mol. Its IUPAC name is 3-[2-[3-[2-(4,4-dihydroxy-2-methylidenebutanoyl)oxyethoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethoxycarbonyl]but-3-enoic acid.
| Compound Name | 3-[2-[3-[2-(4,4-dihydroxy-2-methylidenebutanoyl)oxyethoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethoxycarbonyl]but-3-enoic acid |
|---|---|
| PubChem CID | 134245161 |
| Molecular Formula | C37H48O10 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | 3-[2-[3-[2-(4,4-dihydroxy-2-methylidenebutanoyl)oxyethoxy]-5-[4-(4-pentylcyclohexyl)phenyl]phenoxy]ethoxycarbonyl]but-3-enoic acid |
| SMILES | C=C(CC(=O)O)C(=O)OCCOc1cc(OCCOC(=O)C(=C)CC(O)O)cc(-c2ccc(C3CCC(CCCCC)CC3)cc2)c1 |
| InChI | InChI=1S/C37H48O10/c1-4-5-6-7-27-8-10-28(11-9-27)29-12-14-30(15-13-29)31-22-32(44-16-18-46-36(42)25(2)20-34(38)39)24-33(23-31)45-17-19-47-37(43)26(3)21-35(40)41/h12-15,22-24,27-28,34,38-39H,2-11,16-21H2,1H3,(H,40,41) |
| InChIKey | LFERZIUPUCHLLX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|