C48H67FO11 — CID 155119771
2-O-[4-[4-[2-[3-(2-fluoroprop-2-enoyloxy)propyl]-6-(3-methoxypropyl)-4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]butoxycarbonyl]-2-(methoxymethyl)pent-4-enyl] 1-O-methyl oxalate (PubChem CID 155119771) has the molecular formula C48H67FO11 and a molecular weight of 839.05 g/mol. Its IUPAC name is 2-O-[4-[4-[2-[3-(2-fluoroprop-2-enoyloxy)propyl]-6-(3-methoxypropyl)-4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]butoxycarbonyl]-2-(methoxymethyl)pent-4-enyl] 1-O-methyl oxalate.
| Compound Name | 2-O-[4-[4-[2-[3-(2-fluoroprop-2-enoyloxy)propyl]-6-(3-methoxypropyl)-4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]butoxycarbonyl]-2-(methoxymethyl)pent-4-enyl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 155119771 |
| Molecular Formula | C48H67FO11 |
| Molecular Weight | 839.05 g/mol |
| Exact Mass | 838.47 |
| IUPAC Name | 2-O-[4-[4-[2-[3-(2-fluoroprop-2-enoyloxy)propyl]-6-(3-methoxypropyl)-4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]butoxycarbonyl]-2-(methoxymethyl)pent-4-enyl] 1-O-methyl oxalate |
| SMILES | C=C(F)C(=O)OCCCc1cc(-c2ccc(C3CCC(CCCCC)CC3)cc2)cc(CCCOC)c1OCCCCOC(=O)C(=C)CC(COC)COC(=O)C(=O)OC |
| InChI | InChI=1S/C48H67FO11/c1-7-8-9-14-36-17-19-38(20-18-36)39-21-23-40(24-22-39)43-30-41(15-12-25-54-4)44(42(31-43)16-13-28-59-46(51)35(3)49)57-26-10-11-27-58-45(50)34(2)29-37(32-55-5)33-60-48(53)47(52)56-6/h21-24,30-31,36-38H,2-3,7-20,25-29,32-33H2,1,4-6H3 |
| InChIKey | PFFMIVCWTFFOKX-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.05 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|