C39H52O8 — CID 135164111
2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135164111) has the molecular formula C39H52O8 and a molecular weight of 648.84 g/mol. Its IUPAC name is 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135164111 |
| Molecular Formula | C39H52O8 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[4-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC(=O)C(=C)CO)cc(-c2ccc(C3CCC4CC(CCCCC)CCC4C3)cc2)c1 |
| InChI | InChI=1S/C39H52O8/c1-4-5-6-7-29-8-9-34-21-33(15-14-32(34)20-29)30-10-12-31(13-11-30)35-22-36(44-16-18-46-38(42)27(2)25-40)24-37(23-35)45-17-19-47-39(43)28(3)26-41/h10-13,22-24,29,32-34,40-41H,2-9,14-21,25-26H2,1H3 |
| InChIKey | QIRDKMRTLFQRHJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|