C41H50O5 — CID 142282569
2-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethynyl]cyclohexa-1,5-dien-1-yl]phenoxy]ethyl prop-2-enoate (PubChem CID 142282569) has the molecular formula C41H50O5 and a molecular weight of 622.85 g/mol. Its IUPAC name is 2-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethynyl]cyclohexa-1,5-dien-1-yl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethynyl]cyclohexa-1,5-dien-1-yl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 142282569 |
| Molecular Formula | C41H50O5 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | 2-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethynyl]cyclohexa-1,5-dien-1-yl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1cc(OCCC(=C)CO)cc(C2=CCC(C#Cc3ccc(C4CCC(CCCCC)CC4)cc3)C=C2)c1 |
| InChI | InChI=1S/C41H50O5/c1-4-6-7-8-32-11-17-35(18-12-32)36-19-13-33(14-20-36)9-10-34-15-21-37(22-16-34)38-27-39(44-24-23-31(3)30-42)29-40(28-38)45-25-26-46-41(43)5-2/h5,13-15,19-22,27-29,32,34-35,42H,2-4,6-8,11-12,16-18,23-26,30H2,1H3 |
| InChIKey | BYQYWPDVCRJMKD-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|