C35H39F3O4 — CID 135247731
4-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[2-[4-[4-(5,5,5-trifluoropentyl)cyclohexa-1,5-dien-1-yl]phenyl]ethynyl]phenoxy]-2-methylidenebutan-1-ol (PubChem CID 135247731) has the molecular formula C35H39F3O4 and a molecular weight of 580.69 g/mol. Its IUPAC name is 4-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[2-[4-[4-(5,5,5-trifluoropentyl)cyclohexa-1,5-dien-1-yl]phenyl]ethynyl]phenoxy]-2-methylidenebutan-1-ol.
| Compound Name | 4-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[2-[4-[4-(5,5,5-trifluoropentyl)cyclohexa-1,5-dien-1-yl]phenyl]ethynyl]phenoxy]-2-methylidenebutan-1-ol |
|---|---|
| PubChem CID | 135247731 |
| Molecular Formula | C35H39F3O4 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 4-[3-[3-(hydroxymethyl)but-3-enoxy]-5-[2-[4-[4-(5,5,5-trifluoropentyl)cyclohexa-1,5-dien-1-yl]phenyl]ethynyl]phenoxy]-2-methylidenebutan-1-ol |
| SMILES | C=C(CO)CCOc1cc(C#Cc2ccc(C3=CCC(CCCCC(F)(F)F)C=C3)cc2)cc(OCCC(=C)CO)c1 |
| InChI | InChI=1S/C35H39F3O4/c1-26(24-39)16-19-41-33-21-30(22-34(23-33)42-20-17-27(2)25-40)7-6-29-10-14-32(15-11-29)31-12-8-28(9-13-31)5-3-4-18-35(36,37)38/h8,10-15,21-23,28,39-40H,1-5,9,16-20,24-25H2 |
| InChIKey | OUIPUALBUYNPSO-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|