C19H23N — CID 19005384
4-(4-hexylcyclohexa-1,5-dien-1-yl)benzonitrile (PubChem CID 19005384) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-(4-hexylcyclohexa-1,5-dien-1-yl)benzonitrile.
| Compound Name | 4-(4-hexylcyclohexa-1,5-dien-1-yl)benzonitrile |
|---|---|
| PubChem CID | 19005384 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-(4-hexylcyclohexa-1,5-dien-1-yl)benzonitrile |
| SMILES | CCCCCCC1C=CC(c2ccc(C#N)cc2)=CC1 |
| InChI | InChI=1S/C19H23N/c1-2-3-4-5-6-16-7-11-18(12-8-16)19-13-9-17(15-20)10-14-19/h7,9-14,16H,2-6,8H2,1H3 |
| InChIKey | DWNQUSBYRDRFAQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|