C18H23Br — CID 19005410
1-bromo-4-(4-hexylcyclohexa-1,5-dien-1-yl)benzene (PubChem CID 19005410) has the molecular formula C18H23Br and a molecular weight of 319.29 g/mol. Its IUPAC name is 1-bromo-4-(4-hexylcyclohexa-1,5-dien-1-yl)benzene.
| Compound Name | 1-bromo-4-(4-hexylcyclohexa-1,5-dien-1-yl)benzene |
|---|---|
| PubChem CID | 19005410 |
| Molecular Formula | C18H23Br |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-bromo-4-(4-hexylcyclohexa-1,5-dien-1-yl)benzene |
| SMILES | CCCCCCC1C=CC(c2ccc(Br)cc2)=CC1 |
| InChI | InChI=1S/C18H23Br/c1-2-3-4-5-6-15-7-9-16(10-8-15)17-11-13-18(19)14-12-17/h7,9-15H,2-6,8H2,1H3 |
| InChIKey | AMFCYZQFOKYNJV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|