C21H41ClN+ — CID 145093400
4-(4-chlorocyclohexa-2,4-dien-1-yl)butyl-diethyl-methylazanium;hexane (PubChem CID 145093400) has the molecular formula C21H41ClN+ and a molecular weight of 343.02 g/mol. Its IUPAC name is 4-(4-chlorocyclohexa-2,4-dien-1-yl)butyl-diethyl-methylazanium;hexane.
| Compound Name | 4-(4-chlorocyclohexa-2,4-dien-1-yl)butyl-diethyl-methylazanium;hexane |
|---|---|
| PubChem CID | 145093400 |
| Molecular Formula | C21H41ClN+ |
| Molecular Weight | 343.02 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 4-(4-chlorocyclohexa-2,4-dien-1-yl)butyl-diethyl-methylazanium;hexane |
| SMILES | CCCCCC.CC[N+](C)(CC)CCCCC1C=CC(Cl)=CC1 |
| InChI | InChI=1S/C15H27ClN.C6H14/c1-4-17(3,5-2)13-7-6-8-14-9-11-15(16)12-10-14;1-3-5-6-4-2/h9,11-12,14H,4-8,10,13H2,1-3H3;3-6H2,1-2H3/q+1; |
| InChIKey | UQYKVVHHBMJJKC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.02 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|