C14H21N — CID 90815913
4-heptylcyclohexa-1,5-diene-1-carbonitrile (PubChem CID 90815913) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-heptylcyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 4-heptylcyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 90815913 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4-heptylcyclohexa-1,5-diene-1-carbonitrile |
| SMILES | CCCCCCCC1C=CC(C#N)=CC1 |
| InChI | InChI=1S/C14H21N/c1-2-3-4-5-6-7-13-8-10-14(12-15)11-9-13/h8,10-11,13H,2-7,9H2,1H3 |
| InChIKey | WBEPOXYZDTXOCI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|