C7H8N2 — CID 91284894
4-aminocyclohexa-1,5-diene-1-carbonitrile (PubChem CID 91284894) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 4-aminocyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 4-aminocyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 91284894 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 4-aminocyclohexa-1,5-diene-1-carbonitrile |
| SMILES | N#CC1=CCC(N)C=C1 |
| InChI | InChI=1S/C7H8N2/c8-5-6-1-3-7(9)4-2-6/h1-3,7H,4,9H2 |
| InChIKey | FPNOYVZVVHPRFN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |