About 6-methylidenecyclohexa-2,4-dien-1-amine
6-methylidenecyclohexa-2,4-dien-1-amine (PubChem CID 70393655) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is 6-methylidenecyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-methylidenecyclohexa-2,4-dien-1-amine |
| PubChem CID | 70393655 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 6-methylidenecyclohexa-2,4-dien-1-amine |
| SMILES | C=C1C=CC=CC1N |
| InChI | InChI=1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5,7H,1,8H2 |
| InChIKey | SJWBWCNKADNPGC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methylidenecyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidenecyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-methylidenecyclohexa-2,4-dien-1-amine (CID 70393655) is 6-methylidenecyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-methylidenecyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-methylidenecyclohexa-2,4-dien-1-amine is C=C1C=CC=CC1N.
What is the InChIKey of 6-methylidenecyclohexa-2,4-dien-1-amine?
The InChIKey is SJWBWCNKADNPGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5,7H,1,8H2.
What are the key properties of 6-methylidenecyclohexa-2,4-dien-1-amine?
6-methylidenecyclohexa-2,4-dien-1-amine has a molecular weight of 107.16 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidenecyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 70393655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).