C28H45NO3 — CID 145480810
4-[(E)-2-acetylhept-1-enyl]cyclohexa-1,5-diene-1-carbonitrile;ethane;4-methyl-5-pentyloxolan-2-one (PubChem CID 145480810) has the molecular formula C28H45NO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is 4-[(E)-2-acetylhept-1-enyl]cyclohexa-1,5-diene-1-carbonitrile;ethane;4-methyl-5-pentyloxolan-2-one.
| Compound Name | 4-[(E)-2-acetylhept-1-enyl]cyclohexa-1,5-diene-1-carbonitrile;ethane;4-methyl-5-pentyloxolan-2-one |
|---|---|
| PubChem CID | 145480810 |
| Molecular Formula | C28H45NO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | 4-[(E)-2-acetylhept-1-enyl]cyclohexa-1,5-diene-1-carbonitrile;ethane;4-methyl-5-pentyloxolan-2-one |
| SMILES | CC.CCCCC/C(=C\C1C=CC(C#N)=CC1)C(C)=O.CCCCCC1OC(=O)CC1C |
| InChI | InChI=1S/C16H21NO.C10H18O2.C2H6/c1-3-4-5-6-16(13(2)18)11-14-7-9-15(12-17)10-8-14;1-3-4-5-6-9-8(2)7-10(11)12-9;1-2/h7,9-11,14H,3-6,8H2,1-2H3;8-9H,3-7H2,1-2H3;1-2H3/b16-11+;; |
| InChIKey | LSCDVVMGIDJDRJ-RPVSWQTKSA-N |
| XLogP | 7.65 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|