C18H34O3 — CID 170769406
butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione (PubChem CID 170769406) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione.
| Compound Name | butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione |
|---|---|
| PubChem CID | 170769406 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione |
| SMILES | CCCC.CCCCCC[C@H]1OC(=O)CCC(=O)C[C@H]1C |
| InChI | InChI=1S/C14H24O3.C4H10/c1-3-4-5-6-7-13-11(2)10-12(15)8-9-14(16)17-13;1-3-4-2/h11,13H,3-10H2,1-2H3;3-4H2,1-2H3/t11-,13-;/m1./s1 |
| InChIKey | DMJABIALBNAQSG-LOCPCMAASA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|