About butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione
butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione (PubChem CID 170769406) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione.
Molecular Properties
| Compound Name | butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione |
| PubChem CID | 170769406 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione |
| SMILES | CCCC.CCCCCC[C@H]1OC(=O)CCC(=O)C[C@H]1C |
| InChI | InChI=1S/C14H24O3.C4H10/c1-3-4-5-6-7-13-11(2)10-12(15)8-9-14(16)17-13;1-3-4-2/h11,13H,3-10H2,1-2H3;3-4H2,1-2H3/t11-,13-;/m1./s1 |
| InChIKey | DMJABIALBNAQSG-LOCPCMAASA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione?
The IUPAC name of butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione (CID 170769406) is butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione.
What is the SMILES notation for butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione?
The canonical SMILES for butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione is CCCC.CCCCCC[C@H]1OC(=O)CCC(=O)C[C@H]1C.
What is the InChIKey of butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione?
The InChIKey is DMJABIALBNAQSG-LOCPCMAASA-N. The full InChI is InChI=1S/C14H24O3.C4H10/c1-3-4-5-6-7-13-11(2)10-12(15)8-9-14(16)17-13;1-3-4-2/h11,13H,3-10H2,1-2H3;3-4H2,1-2H3/t11-,13-;/m1./s1.
What are the key properties of butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione?
butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione has a molecular weight of 298.47 g/mol, XLogP of 5.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;(7R,8R)-8-hexyl-7-methyloxocane-2,5-dione is sourced from PubChem (CID 170769406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).