About 6-undecyloxane-2,5-dione
6-undecyloxane-2,5-dione (PubChem CID 70399836) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 6-undecyloxane-2,5-dione.
Molecular Properties
| Compound Name | 6-undecyloxane-2,5-dione |
| PubChem CID | 70399836 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 6-undecyloxane-2,5-dione |
| SMILES | CCCCCCCCCCCC1OC(=O)CCC1=O |
| InChI | InChI=1S/C16H28O3/c1-2-3-4-5-6-7-8-9-10-11-15-14(17)12-13-16(18)19-15/h15H,2-13H2,1H3 |
| InChIKey | ZYJLAEVPWUTSDZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-undecyloxane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-undecyloxane-2,5-dione?
The IUPAC name of 6-undecyloxane-2,5-dione (CID 70399836) is 6-undecyloxane-2,5-dione.
What is the SMILES notation for 6-undecyloxane-2,5-dione?
The canonical SMILES for 6-undecyloxane-2,5-dione is CCCCCCCCCCCC1OC(=O)CCC1=O.
What is the InChIKey of 6-undecyloxane-2,5-dione?
The InChIKey is ZYJLAEVPWUTSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-2-3-4-5-6-7-8-9-10-11-15-14(17)12-13-16(18)19-15/h15H,2-13H2,1H3.
What are the key properties of 6-undecyloxane-2,5-dione?
6-undecyloxane-2,5-dione has a molecular weight of 268.40 g/mol, XLogP of 4.18, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-undecyloxane-2,5-dione is sourced from PubChem (CID 70399836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).