C22H30 — CID 19005523
[4-(4-butylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzene (PubChem CID 19005523) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is [4-(4-butylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzene.
| Compound Name | [4-(4-butylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzene |
|---|---|
| PubChem CID | 19005523 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | [4-(4-butylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzene |
| SMILES | CCCCC1CCC(C2C=CC(c3ccccc3)=CC2)CC1 |
| InChI | InChI=1S/C22H30/c1-2-3-7-18-10-12-20(13-11-18)22-16-14-21(15-17-22)19-8-5-4-6-9-19/h4-6,8-9,14-16,18,20,22H,2-3,7,10-13,17H2,1H3 |
| InChIKey | RPZSABWPHXVKCP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |