C22H34O — CID 145172633
4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 145172633) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 145172633 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | CCCC1CCC(C2CCC(C3C=CC(C=O)=CC3)CC2)CC1 |
| InChI | InChI=1S/C22H34O/c1-2-3-17-4-8-19(9-5-17)21-12-14-22(15-13-21)20-10-6-18(16-23)7-11-20/h6-7,10,16-17,19-22H,2-5,8-9,11-15H2,1H3 |
| InChIKey | DYSJTYSROZCVHI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|