About 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile
4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile (PubChem CID 19005313) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile |
| PubChem CID | 19005313 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile |
| SMILES | CC1CCC(C2C=CC(c3ccc(C#N)cc3)=CC2)CC1 |
| InChI | InChI=1S/C20H23N/c1-15-2-6-17(7-3-15)19-10-12-20(13-11-19)18-8-4-16(14-21)5-9-18/h4-5,8-10,12-13,15,17,19H,2-3,6-7,11H2,1H3 |
| InChIKey | LFZWLWIJSSDHST-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile?
The IUPAC name of 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile (CID 19005313) is 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile.
What is the SMILES notation for 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile?
The canonical SMILES for 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile is CC1CCC(C2C=CC(c3ccc(C#N)cc3)=CC2)CC1.
What is the InChIKey of 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile?
The InChIKey is LFZWLWIJSSDHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N/c1-15-2-6-17(7-3-15)19-10-12-20(13-11-19)18-8-4-16(14-21)5-9-18/h4-5,8-10,12-13,15,17,19H,2-3,6-7,11H2,1H3.
What are the key properties of 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile?
4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile has a molecular weight of 277.41 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]benzonitrile is sourced from PubChem (CID 19005313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).