C20H21F2NS — CID 167053657
[2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]phenyl] thiocyanate (PubChem CID 167053657) has the molecular formula C20H21F2NS and a molecular weight of 345.46 g/mol. Its IUPAC name is [2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]phenyl] thiocyanate.
| Compound Name | [2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 167053657 |
| Molecular Formula | C20H21F2NS |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexa-1,5-dien-1-yl]phenyl] thiocyanate |
| SMILES | CC1CCC(C2C=CC(c3cc(F)c(SC#N)c(F)c3)=CC2)CC1 |
| InChI | InChI=1S/C20H21F2NS/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)17-10-18(21)20(24-12-23)19(22)11-17/h6,8-11,13-15H,2-5,7H2,1H3 |
| InChIKey | FKTMFWXYGTWCLI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|