C20H12F3NS — CID 126575236
[2,6-difluoro-4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl] thiocyanate (PubChem CID 126575236) has the molecular formula C20H12F3NS and a molecular weight of 355.38 g/mol. Its IUPAC name is [2,6-difluoro-4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl] thiocyanate.
| Compound Name | [2,6-difluoro-4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 126575236 |
| Molecular Formula | C20H12F3NS |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | [2,6-difluoro-4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl] thiocyanate |
| SMILES | Cc1ccc(-c2ccc(-c3cc(F)c(SC#N)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C20H12F3NS/c1-12-2-4-13(5-3-12)14-6-7-16(17(21)8-14)15-9-18(22)20(25-11-24)19(23)10-15/h2-10H,1H3 |
| InChIKey | VIXIPNOUDODRAI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|