C31H41F3O4 — CID 135247773
4-[3-[2-ethyl-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]phenyl]-5-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol (PubChem CID 135247773) has the molecular formula C31H41F3O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 4-[3-[2-ethyl-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]phenyl]-5-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol.
| Compound Name | 4-[3-[2-ethyl-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]phenyl]-5-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol |
|---|---|
| PubChem CID | 135247773 |
| Molecular Formula | C31H41F3O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 4-[3-[2-ethyl-4-[4-(3,3,3-trifluoropropyl)cyclohexyl]phenyl]-5-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol |
| SMILES | C=C(CO)CCOc1cc(OCCOC)cc(-c2ccc(C3CCC(CCC(F)(F)F)CC3)cc2CC)c1 |
| InChI | InChI=1S/C31H41F3O4/c1-4-24-17-26(25-7-5-23(6-8-25)11-13-31(32,33)34)9-10-30(24)27-18-28(37-14-12-22(2)21-35)20-29(19-27)38-16-15-36-3/h9-10,17-20,23,25,35H,2,4-8,11-16,21H2,1,3H3 |
| InChIKey | YRSUSZNGNSFIPZ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|