C41H56O4 — CID 135247770
4-[5-[2-ethyl-4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol (PubChem CID 135247770) has the molecular formula C41H56O4 and a molecular weight of 612.89 g/mol. Its IUPAC name is 4-[5-[2-ethyl-4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol.
| Compound Name | 4-[5-[2-ethyl-4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol |
|---|---|
| PubChem CID | 135247770 |
| Molecular Formula | C41H56O4 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.42 |
| IUPAC Name | 4-[5-[2-ethyl-4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-(2-methoxyethoxy)phenoxy]-2-methylidenebutan-1-ol |
| SMILES | C=C(CO)CCOc1cc(-c2ccc(-c3ccc(C4CCC(CCCCCCC)CC4)cc3)cc2CC)ccc1OCCOC |
| InChI | InChI=1S/C41H56O4/c1-5-7-8-9-10-11-32-12-14-34(15-13-32)35-16-18-36(19-17-35)37-20-22-39(33(6-2)28-37)38-21-23-40(45-27-26-43-4)41(29-38)44-25-24-31(3)30-42/h16-23,28-29,32,34,42H,3,5-15,24-27,30H2,1-2,4H3 |
| InChIKey | AIVWUEUFMIFXDA-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|