C35H44O7 — CID 142282110
[5-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-methylperoxyphenoxy] 3-hydroxypropaneperoxoate (PubChem CID 142282110) has the molecular formula C35H44O7 and a molecular weight of 576.73 g/mol. Its IUPAC name is [5-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-methylperoxyphenoxy] 3-hydroxypropaneperoxoate.
| Compound Name | [5-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-methylperoxyphenoxy] 3-hydroxypropaneperoxoate |
|---|---|
| PubChem CID | 142282110 |
| Molecular Formula | C35H44O7 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | [5-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-methylperoxyphenoxy] 3-hydroxypropaneperoxoate |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc(OOC)c(OOOC(=O)CCO)c4)cc3CC)cc2)CC1 |
| InChI | InChI=1S/C35H44O7/c1-4-6-7-8-25-9-11-27(12-10-25)28-13-15-29(16-14-28)32-19-17-30(23-26(32)5-2)31-18-20-33(39-38-3)34(24-31)40-42-41-35(37)21-22-36/h13-20,23-25,27,36H,4-12,21-22H2,1-3H3 |
| InChIKey | MOLUGVTYUIECIP-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|