C34H43NO — CID 135218667
1-[4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]anilino]prop-2-en-1-ol (PubChem CID 135218667) has the molecular formula C34H43NO and a molecular weight of 481.72 g/mol. Its IUPAC name is 1-[4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]anilino]prop-2-en-1-ol.
| Compound Name | 1-[4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]anilino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 135218667 |
| Molecular Formula | C34H43NO |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 1-[4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]anilino]prop-2-en-1-ol |
| SMILES | C=CC(O)Nc1ccc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2CC)cc1 |
| InChI | InChI=1S/C34H43NO/c1-4-7-8-9-25-10-12-27(13-11-25)28-14-16-29(17-15-28)31-20-23-33(26(5-2)24-31)30-18-21-32(22-19-30)35-34(36)6-3/h6,14-25,27,34-36H,3-5,7-13H2,1-2H3 |
| InChIKey | PAVKWMXVACXQBH-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|