C36H55NO — CID 142282909
2-[3-ethyl-4-[4-(4-nonylcyclohexyl)phenyl]phenyl]-N,N-dimethylethanamine;prop-2-enal (PubChem CID 142282909) has the molecular formula C36H55NO and a molecular weight of 517.84 g/mol. Its IUPAC name is 2-[3-ethyl-4-[4-(4-nonylcyclohexyl)phenyl]phenyl]-N,N-dimethylethanamine;prop-2-enal.
| Compound Name | 2-[3-ethyl-4-[4-(4-nonylcyclohexyl)phenyl]phenyl]-N,N-dimethylethanamine;prop-2-enal |
|---|---|
| PubChem CID | 142282909 |
| Molecular Formula | C36H55NO |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 517.43 |
| IUPAC Name | 2-[3-ethyl-4-[4-(4-nonylcyclohexyl)phenyl]phenyl]-N,N-dimethylethanamine;prop-2-enal |
| SMILES | C=CC=O.CCCCCCCCCC1CCC(c2ccc(-c3ccc(CCN(C)C)cc3CC)cc2)CC1 |
| InChI | InChI=1S/C33H51N.C3H4O/c1-5-7-8-9-10-11-12-13-27-14-17-30(18-15-27)31-19-21-32(22-20-31)33-23-16-28(24-25-34(3)4)26-29(33)6-2;1-2-3-4/h16,19-23,26-27,30H,5-15,17-18,24-25H2,1-4H3;2-3H,1H2 |
| InChIKey | AVAYBOQYIYDEGG-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|