C37H47NO2 — CID 135214961
N-[2-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]ethyl]-2-methylprop-2-enamide (PubChem CID 135214961) has the molecular formula C37H47NO2 and a molecular weight of 537.79 g/mol. Its IUPAC name is N-[2-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 135214961 |
| Molecular Formula | C37H47NO2 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | N-[2-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCOc1ccc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C37H47NO2/c1-5-7-8-9-28-10-12-30(13-11-28)31-14-16-33(17-15-31)36-23-20-34(26-29(36)6-2)32-18-21-35(22-19-32)40-25-24-38-37(39)27(3)4/h14-23,26,28,30H,3,5-13,24-25H2,1-2,4H3,(H,38,39) |
| InChIKey | BKAZKJVOXKSCDK-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|