C33H42O8 — CID 135164178
[4-[2-ethyl-4-(4-propylcyclohexyl)phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135164178) has the molecular formula C33H42O8 and a molecular weight of 566.69 g/mol. Its IUPAC name is [4-[2-ethyl-4-(4-propylcyclohexyl)phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[2-ethyl-4-(4-propylcyclohexyl)phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135164178 |
| Molecular Formula | C33H42O8 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | [4-[2-ethyl-4-(4-propylcyclohexyl)phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCOc1ccc(-c2ccc(C3CCC(CCC)CC3)cc2CC)cc1OCOC(=O)C(=C)CO |
| InChI | InChI=1S/C33H42O8/c1-5-7-24-8-10-26(11-9-24)27-12-14-29(25(6-2)16-27)28-13-15-30(38-20-40-32(36)22(3)18-34)31(17-28)39-21-41-33(37)23(4)19-35/h12-17,24,26,34-35H,3-11,18-21H2,1-2H3 |
| InChIKey | CHTJEFWUZNKDSR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|