C34H36O5 — CID 146668025
[4-(4-prop-2-enoyloxyphenyl)-2-[4-(4-propylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 146668025) has the molecular formula C34H36O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is [4-(4-prop-2-enoyloxyphenyl)-2-[4-(4-propylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-(4-prop-2-enoyloxyphenyl)-2-[4-(4-propylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668025 |
| Molecular Formula | C34H36O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | [4-(4-prop-2-enoyloxyphenyl)-2-[4-(4-propylcyclohexyl)phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)CO)c(-c3ccc(C4CCC(CCC)CC4)cc3)c2)cc1 |
| InChI | InChI=1S/C34H36O5/c1-4-6-24-7-9-25(10-8-24)26-11-13-28(14-12-26)31-21-29(17-20-32(31)39-34(37)23(3)22-35)27-15-18-30(19-16-27)38-33(36)5-2/h5,11-21,24-25,35H,2-4,6-10,22H2,1H3 |
| InChIKey | FJIOVGXGEJQGPM-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|